Propanehydrazonoyl chloride, N-(4-chlorophenyl)-2-oxo-
CAS No: 18247-78-4
Propane
18247-78-4
propanehydrazonoyl,chloride,chlorophenyl,propane,18247-78-4
2025-10-16 Discover Propanehydrazonoyl chloride, N-(4-chlorophenyl)-2-oxo- (CAS No: 18247-78-4) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.